C20H14FN3O2S2 — CID 108784214
4-fluoro-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide (PubChem CID 108784214) has the molecular formula C20H14FN3O2S2 and a molecular weight of 411.48 g/mol. Its IUPAC name is 4-fluoro-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide.
| Compound Name | 4-fluoro-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 108784214 |
| Molecular Formula | C20H14FN3O2S2 |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.05 |
| IUPAC Name | 4-fluoro-N-[3-(2-pyridin-2-yl-1,3-thiazol-4-yl)phenyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(-c2csc(-c3ccccn3)n2)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H14FN3O2S2/c21-15-7-9-17(10-8-15)28(25,26)24-16-5-3-4-14(12-16)19-13-27-20(23-19)18-6-1-2-11-22-18/h1-13,24H |
| InChIKey | QHQBQKIBTFYBNG-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |