C9H14N2O2S — CID 10878519
methyl (7R,7aS)-2,7a-dimethyl-6,7-dihydro-5H-pyrrolo[2,1-b][1,3,4]thiadiazole-7-carboxylate (PubChem CID 10878519) has the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. Its IUPAC name is methyl (7R,7aS)-2,7a-dimethyl-6,7-dihydro-5H-pyrrolo[2,1-b][1,3,4]thiadiazole-7-carboxylate.
| Compound Name | methyl (7R,7aS)-2,7a-dimethyl-6,7-dihydro-5H-pyrrolo[2,1-b][1,3,4]thiadiazole-7-carboxylate |
|---|---|
| PubChem CID | 10878519 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | methyl (7R,7aS)-2,7a-dimethyl-6,7-dihydro-5H-pyrrolo[2,1-b][1,3,4]thiadiazole-7-carboxylate |
| SMILES | COC(=O)[C@H]1CCN2N=C(C)S[C@@]12C |
| InChI | InChI=1S/C9H14N2O2S/c1-6-10-11-5-4-7(8(12)13-3)9(11,2)14-6/h7H,4-5H2,1-3H3/t7-,9+/m1/s1 |
| InChIKey | HKSDWRCNMWYBHS-APPZFPTMSA-N |
| XLogP | 1.28 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |