C25H21N3O4 — CID 108785217
N-benzhydryl-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide (PubChem CID 108785217) has the molecular formula C25H21N3O4 and a molecular weight of 427.46 g/mol. Its IUPAC name is N-benzhydryl-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide.
| Compound Name | N-benzhydryl-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide |
|---|---|
| PubChem CID | 108785217 |
| Molecular Formula | C25H21N3O4 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | N-benzhydryl-4-hydroxy-1-(2-methoxyphenyl)-6-oxopyridazine-3-carboxamide |
| SMILES | COc1ccccc1-n1nc(C(=O)NC(c2ccccc2)c2ccccc2)c(O)cc1=O |
| InChI | InChI=1S/C25H21N3O4/c1-32-21-15-9-8-14-19(21)28-22(30)16-20(29)24(27-28)25(31)26-23(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-16,23,29H,1H3,(H,26,31) |
| InChIKey | HCLXXMRZSSREMX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |