C13H17NO2 — CID 10878651
1-propan-2-yl-2,3,4,5-tetrahydro-1-benzazepine-7,8-dione (PubChem CID 10878651) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-propan-2-yl-2,3,4,5-tetrahydro-1-benzazepine-7,8-dione.
| Compound Name | 1-propan-2-yl-2,3,4,5-tetrahydro-1-benzazepine-7,8-dione |
|---|---|
| PubChem CID | 10878651 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-propan-2-yl-2,3,4,5-tetrahydro-1-benzazepine-7,8-dione |
| SMILES | CC(C)N1CCCCC2=CC(=O)C(=O)C=C21 |
| InChI | InChI=1S/C13H17NO2/c1-9(2)14-6-4-3-5-10-7-12(15)13(16)8-11(10)14/h7-9H,3-6H2,1-2H3 |
| InChIKey | ASHWBLDCFWFQKK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|