C9H13FO3S — CID 10878672
(3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-5-[(2S)-thiiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 10878672) has the molecular formula C9H13FO3S and a molecular weight of 220.26 g/mol. Its IUPAC name is (3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-5-[(2S)-thiiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-5-[(2S)-thiiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 10878672 |
| Molecular Formula | C9H13FO3S |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | (3aR,5S,6R,6aS)-6-fluoro-2,2-dimethyl-5-[(2S)-thiiran-2-yl]-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3CS3)[C@H](F)[C@H]2O1 |
| InChI | InChI=1S/C9H13FO3S/c1-9(2)12-7-5(10)6(4-3-14-4)11-8(7)13-9/h4-8H,3H2,1-2H3/t4-,5+,6-,7-,8-/m1/s1 |
| InChIKey | TUVCZBVHJLCYKR-OZRXBMAMSA-N |
| XLogP | 1.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|