C19H29N3O2 — CID 108787281
1-[3-(dimethylamino)propyl]-5-oxo-N-(4-propan-2-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 108787281) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-5-oxo-N-(4-propan-2-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | 1-[3-(dimethylamino)propyl]-5-oxo-N-(4-propan-2-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108787281 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-5-oxo-N-(4-propan-2-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)c1ccc(NC(=O)C2CC(=O)N(CCCN(C)C)C2)cc1 |
| InChI | InChI=1S/C19H29N3O2/c1-14(2)15-6-8-17(9-7-15)20-19(24)16-12-18(23)22(13-16)11-5-10-21(3)4/h6-9,14,16H,5,10-13H2,1-4H3,(H,20,24) |
| InChIKey | BYYRWMKLIZFNFH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |