C18H14FIN2OS — CID 108788184
2-(4-fluorophenyl)-N-(4-iodo-2-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide (PubChem CID 108788184) has the molecular formula C18H14FIN2OS and a molecular weight of 452.29 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-(4-iodo-2-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(4-fluorophenyl)-N-(4-iodo-2-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 108788184 |
| Molecular Formula | C18H14FIN2OS |
| Molecular Weight | 452.29 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2-(4-fluorophenyl)-N-(4-iodo-2-methylphenyl)-4-methyl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(I)ccc1NC(=O)c1sc(-c2ccc(F)cc2)nc1C |
| InChI | InChI=1S/C18H14FIN2OS/c1-10-9-14(20)7-8-15(10)22-17(23)16-11(2)21-18(24-16)12-3-5-13(19)6-4-12/h3-9H,1-2H3,(H,22,23) |
| InChIKey | ZZOBLZGGDCCQSK-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|