C16H17N5O — CID 108788938
N-(2-aminoethyl)-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide (PubChem CID 108788938) has the molecular formula C16H17N5O and a molecular weight of 295.35 g/mol. Its IUPAC name is N-(2-aminoethyl)-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-(2-aminoethyl)-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108788938 |
| Molecular Formula | C16H17N5O |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-(2-aminoethyl)-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCCN)cnn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C16H17N5O/c1-11-13(16(22)18-9-8-17)10-19-21(11)15-7-6-12-4-2-3-5-14(12)20-15/h2-7,10H,8-9,17H2,1H3,(H,18,22) |
| InChIKey | DWNNWRNCLSMLKH-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |