C12H24O2Si — CID 10878926
(1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]cyclohex-4-ene-1,2-diol (PubChem CID 10878926) has the molecular formula C12H24O2Si and a molecular weight of 228.41 g/mol. Its IUPAC name is (1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]cyclohex-4-ene-1,2-diol.
| Compound Name | (1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]cyclohex-4-ene-1,2-diol |
|---|---|
| PubChem CID | 10878926 |
| Molecular Formula | C12H24O2Si |
| Molecular Weight | 228.41 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | (1S,2S,3S)-3-[tert-butyl(dimethyl)silyl]cyclohex-4-ene-1,2-diol |
| SMILES | CC(C)(C)[Si](C)(C)[C@H]1C=CC[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H24O2Si/c1-12(2,3)15(4,5)10-8-6-7-9(13)11(10)14/h6,8-11,13-14H,7H2,1-5H3/t9-,10-,11-/m0/s1 |
| InChIKey | IZNSJPFJELPRFX-DCAQKATOSA-N |
| XLogP | 2.55 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.41 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|