C21H21Cl2N3O2 — CID 108791026
N-(2,5-dichlorophenyl)-5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide (PubChem CID 108791026) has the molecular formula C21H21Cl2N3O2 and a molecular weight of 418.32 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(2,5-dichlorophenyl)-5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108791026 |
| Molecular Formula | C21H21Cl2N3O2 |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-(2,5-dichlorophenyl)-5-oxo-1-(4-pyrrolidin-1-ylphenyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C1CC(=O)N(c2ccc(N3CCCC3)cc2)C1 |
| InChI | InChI=1S/C21H21Cl2N3O2/c22-15-3-8-18(23)19(12-15)24-21(28)14-11-20(27)26(13-14)17-6-4-16(5-7-17)25-9-1-2-10-25/h3-8,12,14H,1-2,9-11,13H2,(H,24,28) |
| InChIKey | ZTARXKMDGRUQHT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|