C13H19NO3 — CID 10879149
1-[benzyl(hydroxy)amino]hex-5-ene-2,3-diol (PubChem CID 10879149) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-[benzyl(hydroxy)amino]hex-5-ene-2,3-diol.
| Compound Name | 1-[benzyl(hydroxy)amino]hex-5-ene-2,3-diol |
|---|---|
| PubChem CID | 10879149 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 1-[benzyl(hydroxy)amino]hex-5-ene-2,3-diol |
| SMILES | C=CCC(O)C(O)CN(O)Cc1ccccc1 |
| InChI | InChI=1S/C13H19NO3/c1-2-6-12(15)13(16)10-14(17)9-11-7-4-3-5-8-11/h2-5,7-8,12-13,15-17H,1,6,9-10H2 |
| InChIKey | SAELWRQPTLVSQA-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|