C21H23N3O3 — CID 108792078
2-(5,6-dimethyl-1,2-benzoxazol-3-yl)-N-(2-morpholin-4-ylphenyl)acetamide (PubChem CID 108792078) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 2-(5,6-dimethyl-1,2-benzoxazol-3-yl)-N-(2-morpholin-4-ylphenyl)acetamide.
| Compound Name | 2-(5,6-dimethyl-1,2-benzoxazol-3-yl)-N-(2-morpholin-4-ylphenyl)acetamide |
|---|---|
| PubChem CID | 108792078 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 2-(5,6-dimethyl-1,2-benzoxazol-3-yl)-N-(2-morpholin-4-ylphenyl)acetamide |
| SMILES | Cc1cc2onc(CC(=O)Nc3ccccc3N3CCOCC3)c2cc1C |
| InChI | InChI=1S/C21H23N3O3/c1-14-11-16-18(23-27-20(16)12-15(14)2)13-21(25)22-17-5-3-4-6-19(17)24-7-9-26-10-8-24/h3-6,11-12H,7-10,13H2,1-2H3,(H,22,25) |
| InChIKey | HGOBXNJQSRILNL-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |