C23H26N4O2S — CID 108792419
N-[4-(diethylamino)phenyl]-1-(2-methyl-1,3-benzothiazol-5-yl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 108792419) has the molecular formula C23H26N4O2S and a molecular weight of 422.55 g/mol. Its IUPAC name is N-[4-(diethylamino)phenyl]-1-(2-methyl-1,3-benzothiazol-5-yl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | N-[4-(diethylamino)phenyl]-1-(2-methyl-1,3-benzothiazol-5-yl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 108792419 |
| Molecular Formula | C23H26N4O2S |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | N-[4-(diethylamino)phenyl]-1-(2-methyl-1,3-benzothiazol-5-yl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C2CC(=O)N(c3ccc4sc(C)nc4c3)C2)cc1 |
| InChI | InChI=1S/C23H26N4O2S/c1-4-26(5-2)18-8-6-17(7-9-18)25-23(29)16-12-22(28)27(14-16)19-10-11-21-20(13-19)24-15(3)30-21/h6-11,13,16H,4-5,12,14H2,1-3H3,(H,25,29) |
| InChIKey | NOPZEXICHRYZPR-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|