C13H20O4 — CID 10879242
(3aR,4R,7aR)-4-methoxyspiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one (PubChem CID 10879242) has the molecular formula C13H20O4 and a molecular weight of 240.30 g/mol. Its IUPAC name is (3aR,4R,7aR)-4-methoxyspiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one.
| Compound Name | (3aR,4R,7aR)-4-methoxyspiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one |
|---|---|
| PubChem CID | 10879242 |
| Molecular Formula | C13H20O4 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (3aR,4R,7aR)-4-methoxyspiro[4,6,7,7a-tetrahydro-3aH-1,3-benzodioxole-2,1'-cyclohexane]-5-one |
| SMILES | CO[C@H]1C(=O)CC[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C13H20O4/c1-15-11-9(14)5-6-10-12(11)17-13(16-10)7-3-2-4-8-13/h10-12H,2-8H2,1H3/t10-,11+,12-/m1/s1 |
| InChIKey | BRAMNITUGPPCBX-GRYCIOLGSA-N |
| XLogP | 1.81 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |