C12H15N3O3 — CID 10879497
(3aS,4R,6S,6aR)-4-azido-6-(furan-2-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole (PubChem CID 10879497) has the molecular formula C12H15N3O3 and a molecular weight of 249.27 g/mol. Its IUPAC name is (3aS,4R,6S,6aR)-4-azido-6-(furan-2-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole.
| Compound Name | (3aS,4R,6S,6aR)-4-azido-6-(furan-2-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
|---|---|
| PubChem CID | 10879497 |
| Molecular Formula | C12H15N3O3 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | (3aS,4R,6S,6aR)-4-azido-6-(furan-2-yl)-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxole |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](c1ccco1)C[C@H]2N=[N+]=[N-] |
| InChI | InChI=1S/C12H15N3O3/c1-12(2)17-10-7(9-4-3-5-16-9)6-8(14-15-13)11(10)18-12/h3-5,7-8,10-11H,6H2,1-2H3/t7-,8-,10-,11+/m1/s1 |
| InChIKey | YURFJFYMAYXKSN-OYBPUVFXSA-N |
| XLogP | 2.97 |
| TPSA | 80.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|