C15H15ClN2O2 — CID 108795047
N-(4-chlorophenyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide (PubChem CID 108795047) has the molecular formula C15H15ClN2O2 and a molecular weight of 290.75 g/mol. Its IUPAC name is N-(4-chlorophenyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide.
| Compound Name | N-(4-chlorophenyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide |
|---|---|
| PubChem CID | 108795047 |
| Molecular Formula | C15H15ClN2O2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.08 |
| IUPAC Name | N-(4-chlorophenyl)-2-(2,6-dimethyl-4-oxo-1-pyridinyl)acetamide |
| SMILES | Cc1cc(=O)cc(C)n1CC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H15ClN2O2/c1-10-7-14(19)8-11(2)18(10)9-15(20)17-13-5-3-12(16)4-6-13/h3-8H,9H2,1-2H3,(H,17,20) |
| InChIKey | STVDZUPEIXVKCE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |