C13H17NO4 — CID 10879557
1-[(4R,5S)-5-[(E)-2-(furan-2-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methylmethanimine oxide (PubChem CID 10879557) has the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. Its IUPAC name is 1-[(4R,5S)-5-[(E)-2-(furan-2-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methylmethanimine oxide.
| Compound Name | 1-[(4R,5S)-5-[(E)-2-(furan-2-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methylmethanimine oxide |
|---|---|
| PubChem CID | 10879557 |
| Molecular Formula | C13H17NO4 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 1-[(4R,5S)-5-[(E)-2-(furan-2-yl)ethenyl]-2,2-dimethyl-1,3-dioxolan-4-yl]-N-methylmethanimine oxide |
| SMILES | C/[N+]([O-])=C/[C@H]1OC(C)(C)O[C@H]1/C=C/c1ccco1 |
| InChI | InChI=1S/C13H17NO4/c1-13(2)17-11(12(18-13)9-14(3)15)7-6-10-5-4-8-16-10/h4-9,11-12H,1-3H3/b7-6+,14-9-/t11-,12+/m0/s1 |
| InChIKey | CWYCMTDIJZLBHU-TUQYZOFSSA-N |
| XLogP | 2.02 |
| TPSA | 57.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|