C19H20N2O4 — CID 108796107
4-[[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]amino]benzamide (PubChem CID 108796107) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 4-[[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]amino]benzamide.
| Compound Name | 4-[[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]amino]benzamide |
|---|---|
| PubChem CID | 108796107 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 4-[[4-(2-methoxy-5-methylphenyl)-4-oxobutanoyl]amino]benzamide |
| SMILES | COc1ccc(C)cc1C(=O)CCC(=O)Nc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C19H20N2O4/c1-12-3-9-17(25-2)15(11-12)16(22)8-10-18(23)21-14-6-4-13(5-7-14)19(20)24/h3-7,9,11H,8,10H2,1-2H3,(H2,20,24)(H,21,23) |
| InChIKey | IPLSSADTTVFHQK-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |