C17H20N4O3 — CID 108796515
4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]butanoic acid (PubChem CID 108796515) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]butanoic acid.
| Compound Name | 4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 108796515 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4-[[4-[(4,6-dimethylpyrimidin-2-yl)amino]benzoyl]amino]butanoic acid |
| SMILES | Cc1cc(C)nc(Nc2ccc(C(=O)NCCCC(=O)O)cc2)n1 |
| InChI | InChI=1S/C17H20N4O3/c1-11-10-12(2)20-17(19-11)21-14-7-5-13(6-8-14)16(24)18-9-3-4-15(22)23/h5-8,10H,3-4,9H2,1-2H3,(H,18,24)(H,22,23)(H,19,20,21) |
| InChIKey | MZSKXFXZMAZNPK-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|