C13H20O5 — CID 10879702
[(1R)-1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-3-oxopropyl] acetate (PubChem CID 10879702) has the molecular formula C13H20O5 and a molecular weight of 256.30 g/mol. Its IUPAC name is [(1R)-1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-3-oxopropyl] acetate.
| Compound Name | [(1R)-1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-3-oxopropyl] acetate |
|---|---|
| PubChem CID | 10879702 |
| Molecular Formula | C13H20O5 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | [(1R)-1-[(1R,2R)-2-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclopropyl]-3-oxopropyl] acetate |
| SMILES | CC(=O)O[C@H](CC=O)[C@@H]1C[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C13H20O5/c1-8(15)17-11(4-5-14)9-6-10(9)12-7-16-13(2,3)18-12/h5,9-12H,4,6-7H2,1-3H3/t9-,10-,11-,12-/m1/s1 |
| InChIKey | KZISXXUKVWCBFJ-DDHJBXDOSA-N |
| XLogP | 1.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|