C15H16N2O2 — CID 10879707
methyl spiro[1-azabicyclo[4.1.0]heptane-5,3'-indole]-6-carboxylate (PubChem CID 10879707) has the molecular formula C15H16N2O2 and a molecular weight of 256.31 g/mol. Its IUPAC name is methyl spiro[1-azabicyclo[4.1.0]heptane-5,3'-indole]-6-carboxylate.
| Compound Name | methyl spiro[1-azabicyclo[4.1.0]heptane-5,3'-indole]-6-carboxylate |
|---|---|
| PubChem CID | 10879707 |
| Molecular Formula | C15H16N2O2 |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | methyl spiro[1-azabicyclo[4.1.0]heptane-5,3'-indole]-6-carboxylate |
| SMILES | COC(=O)C12CN1CCCC21C=Nc2ccccc21 |
| InChI | InChI=1S/C15H16N2O2/c1-19-13(18)15-10-17(15)8-4-7-14(15)9-16-12-6-3-2-5-11(12)14/h2-3,5-6,9H,4,7-8,10H2,1H3 |
| InChIKey | OQIXTPFEAGVFCL-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 41.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|