C14H18F3NO6 — CID 108797327
2,3,4-trifluoro-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)benzamide (PubChem CID 108797327) has the molecular formula C14H18F3NO6 and a molecular weight of 353.29 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)benzamide.
| Compound Name | 2,3,4-trifluoro-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)benzamide |
|---|---|
| PubChem CID | 108797327 |
| Molecular Formula | C14H18F3NO6 |
| Molecular Weight | 353.29 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | 2,3,4-trifluoro-N-methyl-N-(2,3,4,5,6-pentahydroxyhexyl)benzamide |
| SMILES | CN(CC(O)C(O)C(O)C(O)CO)C(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H18F3NO6/c1-18(4-8(20)12(22)13(23)9(21)5-19)14(24)6-2-3-7(15)11(17)10(6)16/h2-3,8-9,12-13,19-23H,4-5H2,1H3 |
| InChIKey | QLSVCABZVYGHKU-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 121.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.29 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|