C19H14N4O3 — CID 108798676
methyl 2-[(4-cyano-1-phenylpyrazol-5-yl)carbamoyl]benzoate (PubChem CID 108798676) has the molecular formula C19H14N4O3 and a molecular weight of 346.35 g/mol. Its IUPAC name is methyl 2-[(4-cyano-1-phenylpyrazol-5-yl)carbamoyl]benzoate.
| Compound Name | methyl 2-[(4-cyano-1-phenylpyrazol-5-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 108798676 |
| Molecular Formula | C19H14N4O3 |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methyl 2-[(4-cyano-1-phenylpyrazol-5-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)Nc1c(C#N)cnn1-c1ccccc1 |
| InChI | InChI=1S/C19H14N4O3/c1-26-19(25)16-10-6-5-9-15(16)18(24)22-17-13(11-20)12-21-23(17)14-7-3-2-4-8-14/h2-10,12H,1H3,(H,22,24) |
| InChIKey | QQKGCQSXAFSYMM-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |