C15H19NOS — CID 10879874
imino-[(1E,6E)-nona-1,6,8-trienyl]-oxo-phenyl-lambda6-sulfane (PubChem CID 10879874) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is imino-[(1E,6E)-nona-1,6,8-trienyl]-oxo-phenyl-lambda6-sulfane.
| Compound Name | imino-[(1E,6E)-nona-1,6,8-trienyl]-oxo-phenyl-lambda6-sulfane |
|---|---|
| PubChem CID | 10879874 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | imino-[(1E,6E)-nona-1,6,8-trienyl]-oxo-phenyl-lambda6-sulfane |
| SMILES | [H]N=S(=O)(/C=C/CCC/C=C/C=C)c1ccccc1 |
| InChI | InChI=1S/C15H19NOS/c1-2-3-4-5-6-7-11-14-18(16,17)15-12-9-8-10-13-15/h2-4,8-14,16H,1,5-7H2/b4-3+,14-11+ |
| InChIKey | QDKFHSJZHGYHER-OWYQYGRNSA-N |
| XLogP | 4.52 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|