C19H12ClF3N2O — CID 108799495
7-chloro-N-(2,3,4-trifluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide (PubChem CID 108799495) has the molecular formula C19H12ClF3N2O and a molecular weight of 376.77 g/mol. Its IUPAC name is 7-chloro-N-(2,3,4-trifluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide.
| Compound Name | 7-chloro-N-(2,3,4-trifluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
|---|---|
| PubChem CID | 108799495 |
| Molecular Formula | C19H12ClF3N2O |
| Molecular Weight | 376.77 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 7-chloro-N-(2,3,4-trifluorophenyl)-2,3-dihydro-1H-cyclopenta[b]quinoline-9-carboxamide |
| SMILES | O=C(Nc1ccc(F)c(F)c1F)c1c2c(nc3ccc(Cl)cc13)CCC2 |
| InChI | InChI=1S/C19H12ClF3N2O/c20-9-4-6-14-11(8-9)16(10-2-1-3-13(10)24-14)19(26)25-15-7-5-12(21)17(22)18(15)23/h4-8H,1-3H2,(H,25,26) |
| InChIKey | HIZOVFRQQIQWMN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.77 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|