C20H15N7O4S — CID 108800998
4-methyl-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide (PubChem CID 108800998) has the molecular formula C20H15N7O4S and a molecular weight of 449.45 g/mol. Its IUPAC name is 4-methyl-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide.
| Compound Name | 4-methyl-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 108800998 |
| Molecular Formula | C20H15N7O4S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | 4-methyl-N-[6-(4-nitrophenyl)-[1,3]thiazolo[3,2-b][1,2,4]triazol-2-yl]-2-oxo-3H-pyrido[1,2-a]pyrimidine-4-carboxamide |
| SMILES | CC1(C(=O)Nc2nc3scc(-c4ccc([N+](=O)[O-])cc4)n3n2)CC(=O)N=C2C=CC=CN21 |
| InChI | InChI=1S/C20H15N7O4S/c1-20(10-16(28)21-15-4-2-3-9-25(15)20)17(29)22-18-23-19-26(24-18)14(11-32-19)12-5-7-13(8-6-12)27(30)31/h2-9,11H,10H2,1H3,(H,22,24,29) |
| InChIKey | ZAOIKRWCLZFGNT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|