C21H22N2O5 — CID 108801215
3-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methylbenzoic acid (PubChem CID 108801215) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is 3-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methylbenzoic acid.
| Compound Name | 3-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methylbenzoic acid |
|---|---|
| PubChem CID | 108801215 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 3-[[1-(2-methoxy-5-methylphenyl)-5-oxopyrrolidine-3-carbonyl]amino]-4-methylbenzoic acid |
| SMILES | COc1ccc(C)cc1N1CC(C(=O)Nc2cc(C(=O)O)ccc2C)CC1=O |
| InChI | InChI=1S/C21H22N2O5/c1-12-4-7-18(28-3)17(8-12)23-11-15(10-19(23)24)20(25)22-16-9-14(21(26)27)6-5-13(16)2/h4-9,15H,10-11H2,1-3H3,(H,22,25)(H,26,27) |
| InChIKey | JATOAYKIYFPGNQ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |