C22H22FN3O3S — CID 108802533
6-fluoro-2-methyl-N-(4-piperidin-1-ylsulfonylphenyl)quinoline-4-carboxamide (PubChem CID 108802533) has the molecular formula C22H22FN3O3S and a molecular weight of 427.50 g/mol. Its IUPAC name is 6-fluoro-2-methyl-N-(4-piperidin-1-ylsulfonylphenyl)quinoline-4-carboxamide.
| Compound Name | 6-fluoro-2-methyl-N-(4-piperidin-1-ylsulfonylphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 108802533 |
| Molecular Formula | C22H22FN3O3S |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 6-fluoro-2-methyl-N-(4-piperidin-1-ylsulfonylphenyl)quinoline-4-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)c2cc(F)ccc2n1 |
| InChI | InChI=1S/C22H22FN3O3S/c1-15-13-20(19-14-16(23)5-10-21(19)24-15)22(27)25-17-6-8-18(9-7-17)30(28,29)26-11-3-2-4-12-26/h5-10,13-14H,2-4,11-12H2,1H3,(H,25,27) |
| InChIKey | XTRSLYSOWOITLV-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |