C18H24ClNO2 — CID 108802886
N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-chlorophenoxy)propanamide (PubChem CID 108802886) has the molecular formula C18H24ClNO2 and a molecular weight of 321.85 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-chlorophenoxy)propanamide.
| Compound Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 108802886 |
| Molecular Formula | C18H24ClNO2 |
| Molecular Weight | 321.85 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]heptanyl)ethyl]-3-(4-chlorophenoxy)propanamide |
| SMILES | CC(NC(=O)CCOc1ccc(Cl)cc1)C1CC2CCC1C2 |
| InChI | InChI=1S/C18H24ClNO2/c1-12(17-11-13-2-3-14(17)10-13)20-18(21)8-9-22-16-6-4-15(19)5-7-16/h4-7,12-14,17H,2-3,8-11H2,1H3,(H,20,21) |
| InChIKey | MGCHSTRZPBFZNY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.85 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |