About 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid
2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid (PubChem CID 108803564) has the molecular formula C21H19N3O4
and a molecular weight of 377.40 g/mol. Its IUPAC name is 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid.
Molecular Properties
| Compound Name | 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid |
| PubChem CID | 108803564 |
| Molecular Formula | C21H19N3O4 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid |
| SMILES | CC(C)(NC(=O)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C21H19N3O4/c1-21(2,20(27)28)22-18(25)16-15(13-9-5-3-6-10-13)17(23-24-19(16)26)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,22,25)(H,24,26)(H,27,28) |
| InChIKey | GRVJRPZVEARQHS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid?
The IUPAC name of 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid (CID 108803564) is 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid.
What is the SMILES notation for 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid?
The canonical SMILES for 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid is CC(C)(NC(=O)c1c(-c2ccccc2)c(-c2ccccc2)n[nH]c1=O)C(=O)O.
What is the InChIKey of 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid?
The InChIKey is GRVJRPZVEARQHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19N3O4/c1-21(2,20(27)28)22-18(25)16-15(13-9-5-3-6-10-13)17(23-24-19(16)26)14-11-7-4-8-12-14/h3-12H,1-2H3,(H,22,25)(H,24,26)(H,27,28).
What are the key properties of 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid?
2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid has a molecular weight of 377.40 g/mol, XLogP of 2.70, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(6-oxo-3,4-diphenyl-1H-pyridazine-5-carbonyl)amino]propanoic acid is sourced from PubChem (CID 108803564), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).