C18H30O2 — CID 10880438
2,4,6-tritert-butyl-4-hydroxycyclohexa-2,5-dien-1-one (PubChem CID 10880438) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-4-hydroxycyclohexa-2,5-dien-1-one.
| Compound Name | 2,4,6-tritert-butyl-4-hydroxycyclohexa-2,5-dien-1-one |
|---|---|
| PubChem CID | 10880438 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | 2,4,6-tritert-butyl-4-hydroxycyclohexa-2,5-dien-1-one |
| SMILES | CC(C)(C)C1=CC(O)(C(C)(C)C)C=C(C(C)(C)C)C1=O |
| InChI | InChI=1S/C18H30O2/c1-15(2,3)12-10-18(20,17(7,8)9)11-13(14(12)19)16(4,5)6/h10-11,20H,1-9H3 |
| InChIKey | WMRAVYBVFIBGHB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |