C23H16ClN5O3 — CID 108806301
N-(4-chloro-2-nitrophenyl)-3-indolo[3,2-b]quinoxalin-6-ylpropanamide (PubChem CID 108806301) has the molecular formula C23H16ClN5O3 and a molecular weight of 445.87 g/mol. Its IUPAC name is N-(4-chloro-2-nitrophenyl)-3-indolo[3,2-b]quinoxalin-6-ylpropanamide.
| Compound Name | N-(4-chloro-2-nitrophenyl)-3-indolo[3,2-b]quinoxalin-6-ylpropanamide |
|---|---|
| PubChem CID | 108806301 |
| Molecular Formula | C23H16ClN5O3 |
| Molecular Weight | 445.87 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | N-(4-chloro-2-nitrophenyl)-3-indolo[3,2-b]quinoxalin-6-ylpropanamide |
| SMILES | O=C(CCn1c2ccccc2c2nc3ccccc3nc21)Nc1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H16ClN5O3/c24-14-9-10-18(20(13-14)29(31)32)25-21(30)11-12-28-19-8-4-1-5-15(19)22-23(28)27-17-7-3-2-6-16(17)26-22/h1-10,13H,11-12H2,(H,25,30) |
| InChIKey | CRQFMRQCMAYREY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.87 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|