About (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone
(2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone (PubChem CID 10880697) has the molecular formula C16H17NO4
and a molecular weight of 287.32 g/mol. Its IUPAC name is (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone.
Molecular Properties
| Compound Name | (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone |
| PubChem CID | 10880697 |
| Molecular Formula | C16H17NO4 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.12 |
| IUPAC Name | (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone |
| SMILES | COc1cc(C(=O)c2ccccc2N)cc(OC)c1OC |
| InChI | InChI=1S/C16H17NO4/c1-19-13-8-10(9-14(20-2)16(13)21-3)15(18)11-6-4-5-7-12(11)17/h4-9H,17H2,1-3H3 |
| InChIKey | UUWNPIZRFIINAA-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone?
The IUPAC name of (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone (CID 10880697) is (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone.
What is the SMILES notation for (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone?
The canonical SMILES for (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone is COc1cc(C(=O)c2ccccc2N)cc(OC)c1OC.
What is the InChIKey of (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone?
The InChIKey is UUWNPIZRFIINAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO4/c1-19-13-8-10(9-14(20-2)16(13)21-3)15(18)11-6-4-5-7-12(11)17/h4-9H,17H2,1-3H3.
What are the key properties of (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone?
(2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone has a molecular weight of 287.32 g/mol, XLogP of 2.53, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-aminophenyl)-(3,4,5-trimethoxyphenyl)methanone is sourced from PubChem (CID 10880697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).