C19H28O2 — CID 10880743
(1'S,5'R,7'S)-7'-[(3E)-hexa-3,5-dienyl]-1'-prop-1-en-2-ylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane] (PubChem CID 10880743) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (1'S,5'R,7'S)-7'-[(3E)-hexa-3,5-dienyl]-1'-prop-1-en-2-ylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane].
| Compound Name | (1'S,5'R,7'S)-7'-[(3E)-hexa-3,5-dienyl]-1'-prop-1-en-2-ylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane] |
|---|---|
| PubChem CID | 10880743 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (1'S,5'R,7'S)-7'-[(3E)-hexa-3,5-dienyl]-1'-prop-1-en-2-ylspiro[1,3-dioxolane-2,4'-bicyclo[3.2.1]octane] |
| SMILES | C=C/C=C/CC[C@H]1C[C@@H]2C[C@@]1(C(=C)C)CCC21OCCO1 |
| InChI | InChI=1S/C19H28O2/c1-4-5-6-7-8-16-13-17-14-18(16,15(2)3)9-10-19(17)20-11-12-21-19/h4-6,16-17H,1-2,7-14H2,3H3/b6-5+/t16-,17+,18+/m0/s1 |
| InChIKey | HWBMLAQHPZKUSZ-YSEKLJNJSA-N |
| XLogP | 4.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|