C14H15N3O4S — CID 108807700
3-(1H-imidazol-5-yl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoic acid (PubChem CID 108807700) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoic acid.
| Compound Name | 3-(1H-imidazol-5-yl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoic acid |
|---|---|
| PubChem CID | 108807700 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-(1H-imidazol-5-yl)-2-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]propanoic acid |
| SMILES | O=C(CCC(=O)c1cccs1)NC(Cc1cnc[nH]1)C(=O)O |
| InChI | InChI=1S/C14H15N3O4S/c18-11(12-2-1-5-22-12)3-4-13(19)17-10(14(20)21)6-9-7-15-8-16-9/h1-2,5,7-8,10H,3-4,6H2,(H,15,16)(H,17,19)(H,20,21) |
| InChIKey | KBFLIEDBVDAYBG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 112.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |