C15H13NO5S — CID 108807708
2-hydroxy-4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]benzoic acid (PubChem CID 108807708) has the molecular formula C15H13NO5S and a molecular weight of 319.34 g/mol. Its IUPAC name is 2-hydroxy-4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]benzoic acid.
| Compound Name | 2-hydroxy-4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]benzoic acid |
|---|---|
| PubChem CID | 108807708 |
| Molecular Formula | C15H13NO5S |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.05 |
| IUPAC Name | 2-hydroxy-4-[(4-oxo-4-thiophen-2-ylbutanoyl)amino]benzoic acid |
| SMILES | O=C(CCC(=O)c1cccs1)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C15H13NO5S/c17-11(13-2-1-7-22-13)5-6-14(19)16-9-3-4-10(15(20)21)12(18)8-9/h1-4,7-8,18H,5-6H2,(H,16,19)(H,20,21) |
| InChIKey | CCRGYQPNLLBLGI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |