C18H16ClNO6 — CID 108808232
4-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoic acid (PubChem CID 108808232) has the molecular formula C18H16ClNO6 and a molecular weight of 377.78 g/mol. Its IUPAC name is 4-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoic acid.
| Compound Name | 4-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 108808232 |
| Molecular Formula | C18H16ClNO6 |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | 4-[[4-(5-chloro-2-methoxyphenyl)-4-oxobutanoyl]amino]-2-hydroxybenzoic acid |
| SMILES | COc1ccc(Cl)cc1C(=O)CCC(=O)Nc1ccc(C(=O)O)c(O)c1 |
| InChI | InChI=1S/C18H16ClNO6/c1-26-16-6-2-10(19)8-13(16)14(21)5-7-17(23)20-11-3-4-12(18(24)25)15(22)9-11/h2-4,6,8-9,22H,5,7H2,1H3,(H,20,23)(H,24,25) |
| InChIKey | KITJRBCHYNEZNS-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |