C26H22N4O4 — CID 108808528
methyl 2-hydroxy-3-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]benzoate (PubChem CID 108808528) has the molecular formula C26H22N4O4 and a molecular weight of 454.49 g/mol. Its IUPAC name is methyl 2-hydroxy-3-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]benzoate.
| Compound Name | methyl 2-hydroxy-3-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 108808528 |
| Molecular Formula | C26H22N4O4 |
| Molecular Weight | 454.49 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | methyl 2-hydroxy-3-[[3-[(2-methyl-6-phenylpyrimidin-4-yl)amino]benzoyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)c2cccc(Nc3cc(-c4ccccc4)nc(C)n3)c2)c1O |
| InChI | InChI=1S/C26H22N4O4/c1-16-27-22(17-8-4-3-5-9-17)15-23(28-16)29-19-11-6-10-18(14-19)25(32)30-21-13-7-12-20(24(21)31)26(33)34-2/h3-15,31H,1-2H3,(H,30,32)(H,27,28,29) |
| InChIKey | ASESTRLOLZXRKJ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 113.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.49 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|