C17H24O2S — CID 10880878
(2S,5R)-5-methyl-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-[(E)-prop-1-enyl]oxane (PubChem CID 10880878) has the molecular formula C17H24O2S and a molecular weight of 292.44 g/mol. Its IUPAC name is (2S,5R)-5-methyl-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-[(E)-prop-1-enyl]oxane.
| Compound Name | (2S,5R)-5-methyl-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-[(E)-prop-1-enyl]oxane |
|---|---|
| PubChem CID | 10880878 |
| Molecular Formula | C17H24O2S |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | (2S,5R)-5-methyl-2-[[(R)-(4-methylphenyl)sulfinyl]methyl]-2-[(E)-prop-1-enyl]oxane |
| SMILES | C/C=C/[C@]1(C[S@@](=O)c2ccc(C)cc2)CC[C@@H](C)CO1 |
| InChI | InChI=1S/C17H24O2S/c1-4-10-17(11-9-15(3)12-19-17)13-20(18)16-7-5-14(2)6-8-16/h4-8,10,15H,9,11-13H2,1-3H3/b10-4+/t15-,17-,20-/m1/s1 |
| InChIKey | OYCWKXSNBYWZCP-ZYDSCSFMSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|