C15H18O6 — CID 10880920
(1S,4S,7S,10R,13R,14S)-13,14-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-ene-6,8-dione (PubChem CID 10880920) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (1S,4S,7S,10R,13R,14S)-13,14-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-ene-6,8-dione.
| Compound Name | (1S,4S,7S,10R,13R,14S)-13,14-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-ene-6,8-dione |
|---|---|
| PubChem CID | 10880920 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1S,4S,7S,10R,13R,14S)-13,14-dihydroxy-2,11,11-trimethyl-5,12-dioxatetracyclo[8.2.1.14,7.01,7]tetradec-2-ene-6,8-dione |
| SMILES | CC1=C[C@@H]2OC(=O)[C@@]3(C(=O)C[C@@H]4[C@@H](O)[C@]13OC4(C)C)[C@@H]2O |
| InChI | InChI=1S/C15H18O6/c1-6-4-8-11(18)14(12(19)20-8)9(16)5-7-10(17)15(6,14)21-13(7,2)3/h4,7-8,10-11,17-18H,5H2,1-3H3/t7-,8+,10-,11-,14-,15-/m1/s1 |
| InChIKey | PFIAEVGJGXQPRE-GWORHLKISA-N |
| XLogP | -0.28 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|