About [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate
[(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate (PubChem CID 10880935) has the molecular formula C17H26O4
and a molecular weight of 294.39 g/mol. Its IUPAC name is [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate.
Molecular Properties
| Compound Name | [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate |
| PubChem CID | 10880935 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate |
| SMILES | C=CCCCC(=O)O[C@H]1CCC[C@H]1OC(=O)CCCC=C |
| InChI | InChI=1S/C17H26O4/c1-3-5-7-12-16(18)20-14-10-9-11-15(14)21-17(19)13-8-6-4-2/h3-4,14-15H,1-2,5-13H2/t14-,15+ |
| InChIKey | UQVGTEGRULDPHG-GASCZTMLSA-N |
| XLogP | 3.71 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate?
The IUPAC name of [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate (CID 10880935) is [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate.
What is the SMILES notation for [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate?
The canonical SMILES for [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate is C=CCCCC(=O)O[C@H]1CCC[C@H]1OC(=O)CCCC=C.
What is the InChIKey of [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate?
The InChIKey is UQVGTEGRULDPHG-GASCZTMLSA-N. The full InChI is InChI=1S/C17H26O4/c1-3-5-7-12-16(18)20-14-10-9-11-15(14)21-17(19)13-8-6-4-2/h3-4,14-15H,1-2,5-13H2/t14-,15+.
What are the key properties of [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate?
[(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate has a molecular weight of 294.39 g/mol, XLogP of 3.71, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2S)-2-hex-5-enoyloxycyclopentyl] hex-5-enoate is sourced from PubChem (CID 10880935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).