C17H26O4 — CID 10880938
(1R,3S,5R,6S,8R,10S)-14-methyl-6-(3-methylbut-3-enyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-13-en-5-ol (PubChem CID 10880938) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is (1R,3S,5R,6S,8R,10S)-14-methyl-6-(3-methylbut-3-enyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-13-en-5-ol.
| Compound Name | (1R,3S,5R,6S,8R,10S)-14-methyl-6-(3-methylbut-3-enyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-13-en-5-ol |
|---|---|
| PubChem CID | 10880938 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | (1R,3S,5R,6S,8R,10S)-14-methyl-6-(3-methylbut-3-enyl)-2,7,11-trioxatricyclo[8.4.0.03,8]tetradec-13-en-5-ol |
| SMILES | C=C(C)CC[C@@H]1O[C@@H]2C[C@@H]3OCC=C(C)[C@H]3O[C@H]2C[C@H]1O |
| InChI | InChI=1S/C17H26O4/c1-10(2)4-5-13-12(18)8-14-15(20-13)9-16-17(21-14)11(3)6-7-19-16/h6,12-18H,1,4-5,7-9H2,2-3H3/t12-,13+,14+,15-,16+,17-/m1/s1 |
| InChIKey | JBUQSKQKUMWFNP-DYSFYUKASA-N |
| XLogP | 2.36 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|