C19H26O3 — CID 10881194
2,4-dimethylpentan-3-yl (5R)-2-oxo-5-phenylcyclopentane-1-carboxylate (PubChem CID 10881194) has the molecular formula C19H26O3 and a molecular weight of 302.41 g/mol. Its IUPAC name is 2,4-dimethylpentan-3-yl (5R)-2-oxo-5-phenylcyclopentane-1-carboxylate.
| Compound Name | 2,4-dimethylpentan-3-yl (5R)-2-oxo-5-phenylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 10881194 |
| Molecular Formula | C19H26O3 |
| Molecular Weight | 302.41 g/mol |
| Exact Mass | 302.19 |
| IUPAC Name | 2,4-dimethylpentan-3-yl (5R)-2-oxo-5-phenylcyclopentane-1-carboxylate |
| SMILES | CC(C)C(OC(=O)C1C(=O)CC[C@H]1c1ccccc1)C(C)C |
| InChI | InChI=1S/C19H26O3/c1-12(2)18(13(3)4)22-19(21)17-15(10-11-16(17)20)14-8-6-5-7-9-14/h5-9,12-13,15,17-18H,10-11H2,1-4H3/t15-,17?/m0/s1 |
| InChIKey | LJPALKUVADBXHG-MYJWUSKBSA-N |
| XLogP | 3.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|