C17H20OS2 — CID 10881270
5,5-bis(phenylsulfanyl)pentan-1-ol (PubChem CID 10881270) has the molecular formula C17H20OS2 and a molecular weight of 304.48 g/mol. Its IUPAC name is 5,5-bis(phenylsulfanyl)pentan-1-ol.
| Compound Name | 5,5-bis(phenylsulfanyl)pentan-1-ol |
|---|---|
| PubChem CID | 10881270 |
| Molecular Formula | C17H20OS2 |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 5,5-bis(phenylsulfanyl)pentan-1-ol |
| SMILES | OCCCCC(Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C17H20OS2/c18-14-8-7-13-17(19-15-9-3-1-4-10-15)20-16-11-5-2-6-12-16/h1-6,9-12,17-18H,7-8,13-14H2 |
| InChIKey | UVSQMPXLPVFKKS-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|