About 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid
2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid (PubChem CID 10881360) has the molecular formula C19H17NO3
and a molecular weight of 307.35 g/mol. Its IUPAC name is 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid.
Molecular Properties
| Compound Name | 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid |
| PubChem CID | 10881360 |
| Molecular Formula | C19H17NO3 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid |
| SMILES | O=C1CCc2ccccc2/C1=C/NC(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C19H17NO3/c21-17-11-10-13-6-4-5-9-15(13)16(17)12-20-18(19(22)23)14-7-2-1-3-8-14/h1-9,12,18,20H,10-11H2,(H,22,23)/b16-12- |
| InChIKey | MUZVXAOLMCJRKP-VBKFSLOCSA-N |
| XLogP | 2.96 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid?
The IUPAC name of 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid (CID 10881360) is 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid.
What is the SMILES notation for 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid?
The canonical SMILES for 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid is O=C1CCc2ccccc2/C1=C/NC(C(=O)O)c1ccccc1.
What is the InChIKey of 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid?
The InChIKey is MUZVXAOLMCJRKP-VBKFSLOCSA-N. The full InChI is InChI=1S/C19H17NO3/c21-17-11-10-13-6-4-5-9-15(13)16(17)12-20-18(19(22)23)14-7-2-1-3-8-14/h1-9,12,18,20H,10-11H2,(H,22,23)/b16-12-.
What are the key properties of 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid?
2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid has a molecular weight of 307.35 g/mol, XLogP of 2.96, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(Z)-(2-oxo-3,4-dihydronaphthalen-1-ylidene)methyl]amino]-2-phenylacetic acid is sourced from PubChem (CID 10881360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).