C15H19N5O2 — CID 108814112
1-[4-(4-methylpiperazin-1-yl)phenyl]-3-(1,2-oxazol-5-yl)urea (PubChem CID 108814112) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[4-(4-methylpiperazin-1-yl)phenyl]-3-(1,2-oxazol-5-yl)urea.
| Compound Name | 1-[4-(4-methylpiperazin-1-yl)phenyl]-3-(1,2-oxazol-5-yl)urea |
|---|---|
| PubChem CID | 108814112 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[4-(4-methylpiperazin-1-yl)phenyl]-3-(1,2-oxazol-5-yl)urea |
| SMILES | CN1CCN(c2ccc(NC(=O)Nc3ccno3)cc2)CC1 |
| InChI | InChI=1S/C15H19N5O2/c1-19-8-10-20(11-9-19)13-4-2-12(3-5-13)17-15(21)18-14-6-7-16-22-14/h2-7H,8-11H2,1H3,(H2,17,18,21) |
| InChIKey | IDDFSURUBILTPT-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 73.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|