C14H18N6O — CID 1088144
4,6-bis(ethylamino)-N-phenyl-1,3,5-triazine-2-carboxamide (PubChem CID 1088144) has the molecular formula C14H18N6O and a molecular weight of 286.34 g/mol. Its IUPAC name is 4,6-bis(ethylamino)-N-phenyl-1,3,5-triazine-2-carboxamide.
| Compound Name | 4,6-bis(ethylamino)-N-phenyl-1,3,5-triazine-2-carboxamide |
|---|---|
| PubChem CID | 1088144 |
| Molecular Formula | C14H18N6O |
| Molecular Weight | 286.34 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 4,6-bis(ethylamino)-N-phenyl-1,3,5-triazine-2-carboxamide |
| SMILES | CCNc1nc(NCC)nc(C(=O)Nc2ccccc2)n1 |
| InChI | InChI=1S/C14H18N6O/c1-3-15-13-18-11(19-14(20-13)16-4-2)12(21)17-10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3,(H,17,21)(H2,15,16,18,19,20) |
| InChIKey | ZDOXKFXSDLMDMZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |