About N-(2,2-dimethoxyethyl)-2-isocyanoacetamide
N-(2,2-dimethoxyethyl)-2-isocyanoacetamide (PubChem CID 108814821) has the molecular formula C7H12N2O3
and a molecular weight of 172.18 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2-isocyanoacetamide.
Molecular Properties
| Compound Name | N-(2,2-dimethoxyethyl)-2-isocyanoacetamide |
| PubChem CID | 108814821 |
| Molecular Formula | C7H12N2O3 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.08 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2-isocyanoacetamide |
| SMILES | [C-]#[N+]CC(=O)NCC(OC)OC |
| InChI | InChI=1S/C7H12N2O3/c1-8-4-6(10)9-5-7(11-2)12-3/h7H,4-5H2,2-3H3,(H,9,10) |
| InChIKey | BZVYZDFUMQMOOS-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 51.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(2,2-dimethoxyethyl)-2-isocyanoacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,2-dimethoxyethyl)-2-isocyanoacetamide?
The IUPAC name of N-(2,2-dimethoxyethyl)-2-isocyanoacetamide (CID 108814821) is N-(2,2-dimethoxyethyl)-2-isocyanoacetamide.
What is the SMILES notation for N-(2,2-dimethoxyethyl)-2-isocyanoacetamide?
The canonical SMILES for N-(2,2-dimethoxyethyl)-2-isocyanoacetamide is [C-]#[N+]CC(=O)NCC(OC)OC.
What is the InChIKey of N-(2,2-dimethoxyethyl)-2-isocyanoacetamide?
The InChIKey is BZVYZDFUMQMOOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3/c1-8-4-6(10)9-5-7(11-2)12-3/h7H,4-5H2,2-3H3,(H,9,10).
What are the key properties of N-(2,2-dimethoxyethyl)-2-isocyanoacetamide?
N-(2,2-dimethoxyethyl)-2-isocyanoacetamide has a molecular weight of 172.18 g/mol, XLogP of -0.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,2-dimethoxyethyl)-2-isocyanoacetamide is sourced from PubChem (CID 108814821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).