C18H16N4O5 — CID 108815044
(Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)prop-2-enamide (PubChem CID 108815044) has the molecular formula C18H16N4O5 and a molecular weight of 368.35 g/mol. Its IUPAC name is (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108815044 |
| Molecular Formula | C18H16N4O5 |
| Molecular Weight | 368.35 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | (Z)-2-cyano-N-(3,4-dimethoxyphenyl)-3-(3-nitroanilino)prop-2-enamide |
| SMILES | COc1ccc(NC(=O)/C(C#N)=C\Nc2cccc([N+](=O)[O-])c2)cc1OC |
| InChI | InChI=1S/C18H16N4O5/c1-26-16-7-6-14(9-17(16)27-2)21-18(23)12(10-19)11-20-13-4-3-5-15(8-13)22(24)25/h3-9,11,20H,1-2H3,(H,21,23)/b12-11- |
| InChIKey | SZKDSWZLFSOXNT-QXMHVHEDSA-N |
| XLogP | 3.07 |
| TPSA | 126.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.35 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|