About 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one
4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one (PubChem CID 10881522) has the molecular formula C19H20O2S
and a molecular weight of 312.43 g/mol. Its IUPAC name is 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one.
Molecular Properties
| Compound Name | 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one |
| PubChem CID | 10881522 |
| Molecular Formula | C19H20O2S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one |
| SMILES | O=C1C=C(c2ccccc2)SC2(O1)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C19H20O2S/c20-18-11-17(14-4-2-1-3-5-14)22-19(21-18)15-7-12-6-13(9-15)10-16(19)8-12/h1-5,11-13,15-16H,6-10H2 |
| InChIKey | CZTPFDZFVVNLJZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one?
The IUPAC name of 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one (CID 10881522) is 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one.
What is the SMILES notation for 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one?
The canonical SMILES for 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one is O=C1C=C(c2ccccc2)SC2(O1)C1CC3CC(C1)CC2C3.
What is the InChIKey of 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one?
The InChIKey is CZTPFDZFVVNLJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20O2S/c20-18-11-17(14-4-2-1-3-5-14)22-19(21-18)15-7-12-6-13(9-15)10-16(19)8-12/h1-5,11-13,15-16H,6-10H2.
What are the key properties of 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one?
4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one has a molecular weight of 312.43 g/mol, XLogP of 4.47, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylspiro[1,3-oxathiine-2,2'-adamantane]-6-one is sourced from PubChem (CID 10881522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).